
CAS 1006464-92-1
:6-[3-(Trifluoromethyl)-1H-pyrazol-1-yl]-3-pyridinamine
Description:
6-[3-(Trifluoromethyl)-1H-pyrazol-1-yl]-3-pyridinamine, with the CAS number 1006464-92-1, is a chemical compound characterized by its unique structural features, which include a pyridinamine core and a trifluoromethyl-substituted pyrazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the trifluoromethyl group enhances lipophilicity and may influence the compound's interaction with biological targets. Additionally, the amino group on the pyridine ring can participate in hydrogen bonding, which is crucial for its reactivity and solubility in various solvents. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's stability, reactivity, and potential applications can be influenced by its electronic structure and steric factors, making it a subject of study in various chemical and biological contexts.
Formula:C9H7F3N4
InChI:InChI=1S/C9H7F3N4/c10-9(11,12)7-3-4-16(15-7)8-2-1-6(13)5-14-8/h1-5H,13H2
InChI key:InChIKey=PIQISWUIBQRGOY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NN(C=C1)C2=CC=C(N)C=N2
Synonyms:- 6-[3-(Trifluoromethyl)-1H-pyrazol-1-yl]-3-pyridinamine
- 3-Pyridinamine, 6-[3-(trifluoromethyl)-1H-pyrazol-1-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.