CymitQuimica logo

CAS 1006468-66-1

:

4-(4-Morpholinylcarbonyl)-1H-pyrazole-1-acetic acid

Description:
4-(4-Morpholinylcarbonyl)-1H-pyrazole-1-acetic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a morpholine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of both carboxylic acid and morpholine functional groups. The morpholine group may contribute to its biological activity, potentially influencing its interaction with biological targets. The presence of the pyrazole ring suggests that it may exhibit diverse pharmacological properties, including anti-inflammatory or analgesic effects, which are common in compounds with similar structures. Additionally, the carboxylic acid functionality can participate in hydrogen bonding, enhancing its reactivity and solubility in aqueous environments. Overall, this compound's characteristics make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation through experimental studies.
Formula:C10H13N3O4
InChI:InChI=1S/C10H13N3O4/c14-9(15)7-13-6-8(5-11-13)10(16)12-1-3-17-4-2-12/h5-6H,1-4,7H2,(H,14,15)
InChI key:InChIKey=GSUIMJCXWYSHEP-UHFFFAOYSA-N
SMILES:C(=O)(C1=CN(CC(O)=O)N=C1)N2CCOCC2
Synonyms:
  • 4-(4-Morpholinylcarbonyl)-1H-pyrazole-1-acetic acid
  • 1H-Pyrazole-1-acetic acid, 4-(4-morpholinylcarbonyl)-
  • 2-[4-(morpholine-4-carbonyl)pyrazol-1-yl]acetic acid
  • [4-(morpholin-4-ylcarbonyl)-1H-pyrazol-1-yl]acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.