CAS 1006470-53-6

4-Bromo-1-(1-methylpropyl)-1H-pyrazol-3-amine

Description:

4-Bromo-1-(1-methylpropyl)-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a 1-methylpropyl group at the 1-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The amine functional group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the bromine substituent can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₁₂BrN₃

InChI: InChI=1S/C7H12BrN3/c1-3-5(2)11-4-6(8)7(9)10-11/h4-5H,3H2,1-2H3,(H2,9,10)

InChI key: InChIKey=HNFQAJPOGZLIQK-UHFFFAOYSA-N

SMILES: C(CC)(C)N1C=C(Br)C(N)=N1

Synonyms:

• 4-Bromo-1-(1-methylpropyl)-1H-pyrazol-3-amine
• 1H-Pyrazol-3-amine, 4-bromo-1-(1-methylpropyl)-