CAS 1006471-28-8
:4-Bromo-1H-pyrazole-3-carbonyl chloride
Description:
4-Bromo-1H-pyrazole-3-carbonyl chloride is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a carbonyl chloride functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals due to its ability to participate in nucleophilic substitution reactions. It is important to handle this substance with care, as carbonyl chlorides can be corrosive and may release toxic gases upon hydrolysis. The compound is generally stored in a cool, dry place, away from moisture and incompatible substances. Its physical properties, such as melting point and solubility, can vary based on purity and specific conditions. As with any chemical, appropriate safety measures should be taken when handling 4-Bromo-1H-pyrazole-3-carbonyl chloride, including the use of personal protective equipment and working in a well-ventilated area.
Formula:C4H2BrClN2O
InChI:InChI=1S/C4H2BrClN2O/c5-2-1-7-8-3(2)4(6)9/h1H,(H,7,8)
InChI key:InChIKey=RQMMGBLUQICLPX-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C(Br)=CNN1
Synonyms:- 4-Bromo-1H-pyrazole-3-carbonyl chloride
- 1H-Pyrazole-3-carbonyl chloride, 4-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.