CAS 1006473-58-0

4-Bromo-α-ethyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid

Description:

4-Bromo-α-ethyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom, an ethyl group, and a trifluoromethyl group. This compound features an acetic acid functional group, contributing to its acidic properties. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The bromine atom introduces additional reactivity, potentially allowing for further chemical modifications. The compound's molecular structure suggests it may exhibit interesting interactions with biological targets, which could be explored in medicinal chemistry. Its CAS number, 1006473-58-0, allows for precise identification in chemical databases. Overall, this compound's distinctive features make it a subject of interest in various fields, including organic synthesis and drug development.

Formula: C₈H₈BrF₃N₂O₂

InChI: InChI=1S/C8H8BrF3N2O2/c1-2-5(7(15)16)14-3-4(9)6(13-14)8(10,11)12/h3,5H,2H2,1H3,(H,15,16)

InChI key: InChIKey=IOZRYBVEBFELCA-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CC)N1N=C(C(F)(F)F)C(Br)=C1

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-bromo-α-ethyl-3-(trifluoromethyl)-
• 4-Bromo-α-ethyl-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid

2-[4-Bromo-3-(trifluoromethyl)-1H-pyrazol-1-yl]butanoic acid

CAS: 1006473-58-0

2-[4-Bromo-3-(trifluoromethyl)-1H-pyrazol-1-yl]butanoic acid

Purity: ≥95%

Molecular weight: 301.06g/mol

Ref: 54-PC410481

2-[4-Bromo-3-(trifluoromethyl)-1H-pyrazol-1-yl]butanoic acid

CAS: 1006473-58-0

Versatile small molecule scaffold

Formula: C₈H₈BrF₃N₂O₂

Purity: Min. 95%

Molecular weight: 301.06 g/mol

Ref: 3D-GQB47358