CAS 1006482-79-6

N-(2-Aminoethyl)-3-methyl-1H-pyrazole-1-acetamide

Description:

N-(2-Aminoethyl)-3-methyl-1H-pyrazole-1-acetamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an aminoethyl side chain and an acetamide functional group, contributing to its potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which is common for compounds containing amine and amide functionalities. The presence of the amino group suggests potential for hydrogen bonding, influencing its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological pathways. Its CAS number, 1006482-79-6, allows for precise identification in chemical databases and literature. As with many organic compounds, safety data should be consulted for handling and usage, as it may exhibit specific toxicity or reactivity profiles.

Formula: C₈H₁₄N₄O

InChI: InChI=1S/C8H14N4O/c1-7-2-5-12(11-7)6-8(13)10-4-3-9/h2,5H,3-4,6,9H2,1H3,(H,10,13)

InChI key: InChIKey=NONDTHXMUFYISH-UHFFFAOYSA-N

SMILES: C(C(NCCN)=O)N1C=CC(C)=N1

Synonyms:

• 1H-Pyrazole-1-acetamide, N-(2-aminoethyl)-3-methyl-
• N-(2-Aminoethyl)-3-methyl-1H-pyrazole-1-acetamide