CAS 1006483-02-8

4-Chloro-1-methyl-1H-pyrazole-3-propanoic acid

Description:

4-Chloro-1-methyl-1H-pyrazole-3-propanoic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro substituent at the 4-position and a methyl group at the 1-position contributes to its unique reactivity and properties. This compound is typically classified as a carboxylic acid due to the presence of the propanoic acid moiety, which imparts acidic characteristics. It is often utilized in pharmaceutical and agricultural applications, particularly as a herbicide or in the development of biologically active molecules. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Additionally, its synthesis may involve various organic reactions, including halogenation and carboxylation processes. Safety and handling precautions are essential due to potential toxicity and environmental impact, necessitating proper storage and disposal methods in laboratory and industrial settings.

Formula: C₇H₉ClN₂O₂

InChI: InChI=1S/C7H9ClN2O2/c1-10-4-5(8)6(9-10)2-3-7(11)12/h4H,2-3H2,1H3,(H,11,12)

InChI key: InChIKey=FJQNUNBQWRUPSI-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=NN(C)C=C1Cl

Synonyms:

• 1H-Pyrazole-3-propanoic acid, 4-chloro-1-methyl-
• 4-Chloro-1-methyl-1H-pyrazole-3-propanoic acid

3-(4-Chloro-1-methyl-1H-pyrazol-3-yl)propanoic acid

CAS: 1006483-02-8

Versatile small molecule scaffold

Formula: C₇H₉ClN₂O₂

Purity: Min. 95%

Molecular weight: 188.61 g/mol

Ref: 3D-GQB48302