CAS 1006483-34-6

α,4-Dimethyl-1H-pyrazole-1-ethanamine

Description:

α,4-Dimethyl-1H-pyrazole-1-ethanamine, identified by its CAS number 1006483-34-6, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features two methyl groups at the 4-position and an ethylamine side chain at the 1-position of the pyrazole ring. It is typically a colorless to light yellow liquid or solid, depending on its purity and form. The presence of the amine group suggests that it may exhibit basic properties and can participate in hydrogen bonding, making it potentially useful in various chemical reactions and applications. Its unique structure may also confer specific biological activities, making it of interest in medicinal chemistry and drug development. However, detailed information regarding its solubility, stability, and reactivity would depend on experimental conditions and specific formulations. As with any chemical substance, safety data and handling precautions should be consulted before use.

Formula: C₇H₁₃N₃

InChI: InChI=1S/C7H13N3/c1-6-3-9-10(4-6)5-7(2)8/h3-4,7H,5,8H2,1-2H3

InChI key: InChIKey=PTVGQYPGYSFDRA-UHFFFAOYSA-N

SMILES: C(C(C)N)N1C=C(C)C=N1

Synonyms:

• 1H-Pyrazole-1-ethanamine, α,4-dimethyl-
• α,4-Dimethyl-1H-pyrazole-1-ethanamine