
CAS 1006483-44-8
:5-Methyl-1-propyl-1H-pyrazol-4-amine
Description:
5-Methyl-1-propyl-1H-pyrazol-4-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a propyl group attached to the pyrazole, specifically at the 5 and 1 positions, respectively. The presence of the amino group (-NH2) at the 4 position contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The molecular structure suggests that it may exhibit properties typical of amines, such as hydrogen bonding capabilities, which can influence its solubility in polar solvents. Additionally, the compound may have applications in medicinal chemistry, agrochemicals, or as a building block in organic synthesis due to its unique structural features. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C7H13N3
InChI:InChI=1S/C7H13N3/c1-3-4-10-6(2)7(8)5-9-10/h5H,3-4,8H2,1-2H3
InChI key:InChIKey=YDRLQVQRWYCBKR-UHFFFAOYSA-N
SMILES:C(CC)N1C(C)=C(N)C=N1
Synonyms:- 5-Methyl-1-propyl-1H-pyrazol-4-amine
- 1H-Pyrazol-4-amine, 5-methyl-1-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.