
CAS 1006483-45-9
:α,3-Dimethyl-1-propyl-1H-pyrazole-4-methanamine
Description:
α,3-Dimethyl-1-propyl-1H-pyrazole-4-methanamine, with the CAS number 1006483-45-9, is a chemical compound that belongs to the class of pyrazoles, which are five-membered heterocyclic compounds containing two nitrogen atoms. This substance features a pyrazole ring substituted with a propyl group and two methyl groups, contributing to its unique structural characteristics. It is typically characterized by its moderate polarity, which influences its solubility in various organic solvents. The presence of the amine functional group suggests potential basicity and reactivity, particularly in forming salts or undergoing nucleophilic reactions. The compound may exhibit biological activity, making it of interest in pharmaceutical research, although specific biological properties would depend on further studies. Its stability under standard conditions is generally good, but like many organic compounds, it should be handled with care to avoid degradation or unwanted reactions. Overall, α,3-Dimethyl-1-propyl-1H-pyrazole-4-methanamine represents a versatile structure with potential applications in various chemical and biological contexts.
Formula:C9H17N3
InChI:InChI=1S/C9H17N3/c1-4-5-12-6-9(7(2)10)8(3)11-12/h6-7H,4-5,10H2,1-3H3
InChI key:InChIKey=OQOKDQQDUPTRTA-UHFFFAOYSA-N
SMILES:C(C)(N)C1=CN(CCC)N=C1C
Synonyms:- 1H-Pyrazole-4-methanamine, α,3-dimethyl-1-propyl-
- α,3-Dimethyl-1-propyl-1H-pyrazole-4-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.