CymitQuimica logo

CAS 1006483-57-3

:

4-Amino-N-butyl-1-methyl-1H-pyrazole-5-carboxamide

Description:
4-Amino-N-butyl-1-methyl-1H-pyrazole-5-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an amino group and a butyl side chain, contributing to its solubility and potential biological activity. The presence of the carboxamide functional group enhances its ability to form hydrogen bonds, which can influence its interactions in biological systems. Typically, compounds like this may exhibit properties such as moderate to high polarity, making them soluble in polar solvents. The molecular structure suggests potential applications in pharmaceuticals, particularly in areas related to anti-inflammatory or analgesic activities, although specific biological activities would depend on further empirical studies. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Overall, 4-Amino-N-butyl-1-methyl-1H-pyrazole-5-carboxamide represents a class of compounds that may hold significance in medicinal chemistry and drug development.
Formula:C9H16N4O
InChI:InChI=1S/C9H16N4O/c1-3-4-5-11-9(14)8-7(10)6-12-13(8)2/h6H,3-5,10H2,1-2H3,(H,11,14)
InChI key:InChIKey=QBQQXEMVEQXSOP-UHFFFAOYSA-N
SMILES:C(NCCCC)(=O)C1=C(N)C=NN1C
Synonyms:
  • 4-Amino-N-butyl-1-methyl-1H-pyrazole-5-carboxamide
  • 1H-Pyrazole-5-carboxamide, 4-amino-N-butyl-1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.