CAS 1006486-07-2

1H-Pyrazole-3-carboxylic acid, 4-amino-1,5-dimethyl-, methyl ester

Description:

1H-Pyrazole-3-carboxylic acid, 4-amino-1,5-dimethyl-, methyl ester, identified by CAS number 1006486-07-2, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group and an ester moiety, indicating it can participate in various chemical reactions, including esterification and hydrolysis. The presence of amino and methyl groups contributes to its potential biological activity and solubility properties. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological effects. They may exhibit properties such as anti-inflammatory, analgesic, or antimicrobial activities, depending on their specific structure and substituents. Additionally, the compound's stability, reactivity, and interactions with other molecules can be influenced by its functional groups and overall molecular geometry. As with many pyrazole derivatives, it may also serve as a building block for the synthesis of more complex molecules in drug development and agrochemical applications.

Formula: C₇H₁₁N₃O₂

InChI: InChI=1S/C7H11N3O2/c1-4-5(8)6(7(11)12-3)9-10(4)2/h8H2,1-3H3

InChI key: InChIKey=PPPYRJSMLGWDHP-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(N)=C(C)N(C)N1

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 4-amino-1,5-dimethyl-, methyl ester
• Methyl 4-amino-1,5-dimethyl-1H-pyrazole-3-carboxylate

Methyl 4-amino-1,5-dimethyl-1H-pyrazole-3-carboxylate

CAS: 1006486-07-2

Versatile small molecule scaffold

Formula: C₇H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 169.18 g/mol

Ref: 3D-GQB48607