CAS 1006486-15-2
:4-Amino-α,3,5-trimethyl-1H-pyrazole-1-acetic acid
Description:
4-Amino-α,3,5-trimethyl-1H-pyrazole-1-acetic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and an acetic acid moiety, contributing to its potential as a biologically active molecule. The presence of three methyl groups at the 3, 5, and α positions enhances its lipophilicity and may influence its interaction with biological targets. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the pyrazole ring may confer specific reactivity and stability under various conditions. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of agents targeting specific enzymes or receptors. Additionally, the compound's unique combination of functional groups may allow for further derivatization, expanding its utility in medicinal chemistry. As with many pyrazole derivatives, it may also exhibit interesting pharmacological properties, warranting further investigation.
Formula:C8H13N3O2
InChI:InChI=1S/C8H13N3O2/c1-4-7(9)5(2)11(10-4)6(3)8(12)13/h6H,9H2,1-3H3,(H,12,13)
InChI key:InChIKey=DLDVUFDCXLMNGF-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)N1C(C)=C(N)C(C)=N1
Synonyms:- 4-Amino-α,3,5-trimethyl-1H-pyrazole-1-acetic acid
- 1H-Pyrazole-1-acetic acid, 4-amino-α,3,5-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.