CAS 1006492-27-8
:1-Methyl-3-[[[3-(4-morpholinyl)propyl]amino]carbonyl]-1H-pyrazole-4-carboxylic acid
Description:
1-Methyl-3-[[[3-(4-morpholinyl)propyl]amino]carbonyl]-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a carboxylic acid functional group, and a morpholine moiety. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of the carboxylic acid and morpholine groups. It may demonstrate biological activity, potentially acting as a pharmaceutical agent due to its ability to interact with biological targets. The presence of the morpholine group suggests possible applications in medicinal chemistry, particularly in the development of drugs targeting specific receptors or enzymes. Additionally, the compound's molecular structure may confer stability and specificity in its interactions, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C13H20N4O4
InChI:InChI=1S/C13H20N4O4/c1-16-9-10(13(19)20)11(15-16)12(18)14-3-2-4-17-5-7-21-8-6-17/h9H,2-8H2,1H3,(H,14,18)(H,19,20)
InChI key:InChIKey=MTXWCTYTMSQZPC-UHFFFAOYSA-N
SMILES:C(NCCCN1CCOCC1)(=O)C=2C(C(O)=O)=CN(C)N2
Synonyms:- 1-Methyl-3-[[[3-(4-morpholinyl)propyl]amino]carbonyl]-1H-pyrazole-4-carboxylic acid
- 1H-Pyrazole-4-carboxylic acid, 1-methyl-3-[[[3-(4-morpholinyl)propyl]amino]carbonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.