CAS 10066-20-3
:1H-Benzimidazole, 1-hydroxy-2-phenyl-, 3-oxide
Description:
1H-Benzimidazole, 1-hydroxy-2-phenyl-, 3-oxide, with the CAS number 10066-20-3, is a chemical compound that features a benzimidazole core, which is a bicyclic structure composed of a fused benzene and imidazole ring. This compound is characterized by the presence of a hydroxyl group (-OH) at the 1-position and a phenyl group at the 2-position of the benzimidazole ring, along with an oxide functionality at the 3-position. The presence of these functional groups contributes to its potential biological activity and reactivity. Typically, compounds of this nature may exhibit properties such as antioxidant activity, and they can be involved in various chemical reactions due to the reactivity of the hydroxyl and oxide groups. Additionally, the structural features may influence its solubility, stability, and interaction with other molecules, making it of interest in fields such as medicinal chemistry and materials science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H10N2O2
InChI:InChI=1S/C13H10N2O2/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9,16H
InChI key:InChIKey=QZXHSJLKZPAUEY-UHFFFAOYSA-N
SMILES:ON1C(=N(=O)C=2C1=CC=CC2)C3=CC=CC=C3
Synonyms:- 1H-Benzimidazole, 1-hydroxy-2-phenyl-, 3-oxide
- Benzimidazole, 1-hydroxy-2-phenyl-, 3-oxide
- 1-Hydroxy-2-phenyl-1H-benzo[d]imidazole 3-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
