CAS 100665-41-6: Lanosta-8,20(22)-dien-26-oicacid, 3,7-dihydroxy-11,15,23-trioxo-, (3b,7b,20E)-

Description:Lanosta-8,20(22)-dien-26-oic acid, 3,7-dihydroxy-11,15,23-trioxo-, (3b,7b,20E)-, with CAS number 100665-41-6, is a complex triterpenoid compound derived from lanosterol, a precursor in the biosynthesis of sterols. This substance features multiple hydroxyl groups and keto functionalities, contributing to its potential biological activity. The presence of a double bond in the lanostane structure indicates its unsaturation, which can influence its reactivity and interaction with biological systems. Triterpenoids like this compound are often studied for their pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. The specific stereochemistry, denoted by the (3b,7b,20E) configuration, plays a crucial role in determining the compound's biological interactions and efficacy. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in both medicinal chemistry and natural product research. Overall, this compound exemplifies the structural diversity and potential therapeutic applications of triterpenoids in biochemistry.

Formula:C₃₀H₄₂O₇

InChI:InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21-22,32,34H,8-9,11-14H2,1-7H3,(H,36,37)

InChI key:InChIKey=QECQJYAIIIIKJB-UHFFFAOYSA-N

SMILES:O=C(O)C(C)CC(=O)C=C(C)C1CC(=O)C2(C3=C(C(=O)CC12C)C4(C)CCC(O)C(C)(C)C4CC3O)C

Synonyms:
(3β,7β,20E)-3,7-Dihydroxy-11,15,23-trioxolanosta-8,20(22)-dien-26-oic acid
Ganoderenic acid b
Ganoderenicacid b
Lanosta-8,20(22)-dien-26-oic acid, 3,7-dihydroxy-11,15,23-trioxo-, (3β,7β,20E)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Ganoderenic acid B REF: TM-T2S1120CAS: 100665-41-6	98%	To inquire	Mon 21 Apr 25
Ganoderenic acid B REF: BP-BP3151CAS: 100665-41-6	95%~99%	187.00 €~1,242.00 €	Tue 22 Apr 25
Ganoderenic acid B REF: 3D-FG74208CAS: 100665-41-6	Min. 95%	726.00 €	Thu 29 May 25