CAS 100667-52-5

(4E)-7-(4-Hydroxyphenyl)-1-phenyl-4-hepten-3-one

Description:

(4E)-7-(4-Hydroxyphenyl)-1-phenyl-4-hepten-3-one, identified by its CAS number 100667-52-5, is an organic compound characterized by its conjugated double bond system and a ketone functional group. This compound features a hepten backbone, which contributes to its unsaturation and potential reactivity. The presence of a hydroxyphenyl group enhances its polarity and may influence its solubility in various solvents, making it more hydrophilic compared to similar compounds without this functional group. The compound's structure suggests it may exhibit interesting optical properties due to its conjugated system, potentially making it useful in applications such as dyes or pharmaceuticals. Additionally, the presence of multiple aromatic rings may impart stability and influence its interaction with biological systems. Overall, the unique combination of functional groups and structural features of this compound may lead to diverse applications in organic synthesis and material science.

Formula: C₁₉H₂₀O₂

InChI: InChI=1S/C19H20O2/c20-18(13-10-16-6-2-1-3-7-16)9-5-4-8-17-11-14-19(21)15-12-17/h1-3,5-7,9,11-12,14-15,21H,4,8,10,13H2/b9-5+

InChI key: InChIKey=VPCHZECKYCDVSA-WEVVVXLNSA-N

SMILES: C(C/C=C/C(CCC1=CC=CC=C1)=O)C2=CC=C(O)C=C2

Synonyms:

• 4-Hepten-3-one, 7-(4-hydroxyphenyl)-1-phenyl-, (4E)-
• (4E)-7-(4-Hydroxyphenyl)-1-phenyl-4-hepten-3-one
• 4-Hepten-3-one, 7-(4-hydroxyphenyl)-1-phenyl-, (E)-

(4E)-7-(4-Hydroxyphenyl)-1-phenyl-4-hepten-3-one

CAS: 100667-52-5

Formula: C₁₉H₂₀O₂

Purity: 97.5%

Molecular weight: 280.3609

Ref: IN-DA0002LG

7-(4-Hydroxyphenyl)-1-phenyl-4-hepten-3-one

CAS: 100667-52-5

7-(4-Hydroxyphenyl)-1-phenyl-4-hepten-3-one as a beneficial compound to ameliorate the deleterious effects of Aβ on dendrite integrity and cell survival, and

Formula: C₁₉H₂₀O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 280.36

Ref: TM-TN3218

7-(4-Hydroxyphenyl)-1-phenyl-4-hepten-3-one

CAS: 100667-52-5

7-(4-Hydroxyphenyl)-1-phenyl-4-hepten-3-one is a synthetic organic compound, which is derived from laboratory-based chemical synthesis processes. This compound is notable for its structural configuration, specifically the presence of phenolic and keto groups, which contribute to its potential biological activity. The synthesis typically involves the controlled reaction of specific precursors under optimized conditions to achieve the desired chemical structure.

Formula: C₁₉H₂₀O₂

Purity: Min. 95%

Molecular weight: 280.40 g/mol

Ref: 3D-AEA66752