CAS 1006682-82-1: 2-[2-[5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]-1-methylethyl]-4-methyl-5-thiazolecarboxylic acid

Description: The chemical substance known as 2-[2-[5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]-1-methylethyl]-4-methyl-5-thiazolecarboxylic acid, with the CAS number 1006682-82-1, is characterized by its complex molecular structure, which includes a thiazole ring, a pyrazole moiety, and a cyclopropyl group. This compound is notable for its potential biological activity, particularly in the field of medicinal chemistry, where it may exhibit properties such as anti-inflammatory or analgesic effects. The presence of trifluoromethyl groups often enhances lipophilicity and metabolic stability, which can influence the pharmacokinetics of the compound. Additionally, the thiazole and pyrazole rings contribute to its reactivity and interaction with biological targets. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, making it a subject of interest for further research in drug development and synthesis. Overall, its unique structural features suggest potential applications in pharmaceuticals and agrochemicals.

Formula: C₁₅H₁₆F₃N₃O₂S

InChI: InChI=1S/C15H16F3N3O2S/c1-7(13-19-8(2)12(24-13)14(22)23)6-21-10(9-3-4-9)5-11(20-21)15(16,17)18/h5,7,9H,3-4,6H2,1-2H3,(H,22,23)

InChI key: InChIKey=WHLDXZNLIXOARA-UHFFFAOYSA-N

SMILES: O=C(O)C=1SC(=NC1C)C(C)CN2N=C(C=C2C3CC3)C(F)(F)F

2-{1-[5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]propan-2-yl}-4-methyl-1,3-thiazole-5-carboxy

CAS: 1006682-82-1

• Molecular weight: 359.37g/mol

2-{1-[5-Cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]propan-2-yl}-4-methyl-1,3-thiazole-5-carboxylic acid

CAS: 1006682-82-1

Versatile small molecule scaffold

• Formula: C₁₅H₁₆F₃N₃O₂S
• Purity: Min. 95%
• Molecular weight: 359.4 g/mol

2-{2-[5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]-1-methylethyl}-4-methyl-1,3-thiazole-5-carboxylic acid

CAS: 1006682-82-1

• Molecular weight: 359.3699951171875