CAS 1006694-45-6

(2E)-2-Cyano-3-phenyl-N-2-thiazolyl-2-propenamide

Description:

(2E)-2-Cyano-3-phenyl-N-2-thiazolyl-2-propenamide is a chemical compound characterized by its unique structural features, including a cyano group, a phenyl ring, and a thiazole moiety. This compound belongs to the class of propenamides, which are known for their diverse biological activities. The presence of the cyano group contributes to its reactivity, while the thiazole ring can enhance its interaction with biological targets, making it of interest in medicinal chemistry. The compound's E configuration indicates the specific geometric arrangement around the double bond, which can influence its physical and chemical properties, such as solubility and stability. Additionally, the presence of multiple functional groups suggests potential for various chemical reactions, including nucleophilic additions and substitutions. Overall, (2E)-2-Cyano-3-phenyl-N-2-thiazolyl-2-propenamide is a compound with significant potential for research and application in pharmaceuticals and agrochemicals, warranting further investigation into its properties and activities.

Formula: C₁₃H₉N₃OS

InChI: InChI=1S/C13H9N3OS/c14-9-11(8-10-4-2-1-3-5-10)12(17)16-13-15-6-7-18-13/h1-8H,(H,15,16,17)/b11-8+

InChI key: InChIKey=MJIDWXYGAAMSEW-DHZHZOJOSA-N

SMILES: C(=C(/C(NC1=NC=CS1)=O)\C#N)\C2=CC=CC=C2

Synonyms:

• (2E)-2-Cyano-3-phenyl-N-2-thiazolyl-2-propenamide
• 2-Propenamide, 2-cyano-3-phenyl-N-2-thiazolyl-, (2E)-