CymitQuimica logo

CAS 1006950-52-2

:

3-Methoxy-4-nitro-1H-pyrazole-1-ethanol

Description:
3-Methoxy-4-nitro-1H-pyrazole-1-ethanol, identified by its CAS number 1006950-52-2, is a chemical compound that features a pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a methoxy group (-OCH3) and a nitro group (-NO2) attached to the pyrazole ring, as well as a hydroxyl group (-OH) linked to an ethyl chain. These functional groups contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methoxy group can enhance lipophilicity, while the nitro group may impart specific electronic properties that can influence biological activity. The compound's solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, 3-Methoxy-4-nitro-1H-pyrazole-1-ethanol is of interest for its potential utility in synthetic chemistry and medicinal applications, although specific studies on its biological effects and mechanisms may be limited.
Formula:C6H9N3O4
InChI:InChI=1S/C6H9N3O4/c1-13-6-5(9(11)12)4-8(7-6)2-3-10/h4,10H,2-3H2,1H3
InChI key:InChIKey=GUZXGCLQOGQIPB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(OC)=NN(CCO)C1
Synonyms:
  • 1H-Pyrazole-1-ethanol, 3-methoxy-4-nitro-
  • 3-Methoxy-4-nitro-1H-pyrazole-1-ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.