CAS 1006959-20-1

2-[(1-Methyl-1H-pyrazol-4-yl)methoxy]benzenamine

Description:

2-[(1-Methyl-1H-pyrazol-4-yl)methoxy]benzenamine, identified by its CAS number 1006959-20-1, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with an amine group and a methoxy group linked to a pyrazole moiety. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine and methoxy functional groups. The pyrazole ring contributes to its unique chemical behavior, potentially influencing its biological activity and interactions. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, given the biological significance of both the pyrazole and aniline structures. Safety and handling considerations should be taken into account, as with many organic compounds, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields.

Formula: C₁₁H₁₃N₃O

InChI: InChI=1S/C11H13N3O/c1-14-7-9(6-13-14)8-15-11-5-3-2-4-10(11)12/h2-7H,8,12H2,1H3

InChI key: InChIKey=OPKBTLYJEHINOY-UHFFFAOYSA-N

SMILES: O(CC1=CN(C)N=C1)C2=C(N)C=CC=C2

Synonyms:

• Benzenamine, 2-[(1-methyl-1H-pyrazol-4-yl)methoxy]-
• 2-[(1-Methyl-1H-pyrazol-4-yl)methoxy]benzenamine

2-[(1-Methyl-1H-pyrazol-4-yl)methoxy]aniline

CAS: 1006959-20-1

Versatile small molecule scaffold

Formula: C₁₁H₁₃N₃O

Purity: Min. 95%

Molecular weight: 203.24 g/mol

Ref: 3D-GQB95920