CymitQuimica logo

CAS 1006959-26-7

:

1-Methyl-N-[(5-methyl-2-furanyl)methyl]-1H-pyrazole-4-methanamine

Description:
1-Methyl-N-[(5-methyl-2-furanyl)methyl]-1H-pyrazole-4-methanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring, a furan moiety, and an amine group. The presence of the methyl and furan substituents contributes to its potential biological activity and solubility properties. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic (furan and pyrazole) and hydrophilic (amine) functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for various therapeutic effects. Additionally, the specific arrangement of substituents may influence its reactivity and interaction with biological targets. As with many organic compounds, the stability, solubility, and reactivity can be affected by environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C11H15N3O
InChI:InChI=1S/C11H15N3O/c1-9-3-4-11(15-9)7-12-5-10-6-13-14(2)8-10/h3-4,6,8,12H,5,7H2,1-2H3
InChI key:InChIKey=SDUFCESSPJLXHT-UHFFFAOYSA-N
SMILES:C(NCC=1OC(C)=CC1)C2=CN(C)N=C2
Synonyms:
  • 1H-Pyrazole-4-methanamine, 1-methyl-N-[(5-methyl-2-furanyl)methyl]-
  • 1-Methyl-N-[(5-methyl-2-furanyl)methyl]-1H-pyrazole-4-methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.