CAS 100696-00-2

4,5-Dimethyl-2-(trifluoromethyl)pyridine

Description:

4,5-Dimethyl-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two methyl groups and one trifluoromethyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and interactions with biological systems. This compound typically exhibits a pale yellow to colorless appearance and is known for its aromatic characteristics due to the pyridine structure. It is soluble in organic solvents and may have limited solubility in water. The presence of fluorine atoms contributes to its stability and can impart unique electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as fluorinated compounds can pose unique hazards. Overall, 4,5-Dimethyl-2-(trifluoromethyl)pyridine is a valuable compound in synthetic organic chemistry and material science.

Formula: C₈H₈F₃N

InChI: InChI=1S/C8H8F3N/c1-5-3-7(8(9,10)11)12-4-6(5)2/h3-4H,1-2H3

InChI key: InChIKey=FMFJYDNHFUUBBE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(C)=C(C)C=N1

Synonyms:

• 4,5-Dimethyl-2-(trifluoromethyl)pyridine
• Pyridine, 4,5-dimethyl-2-(trifluoromethyl)-