
CAS 100696-30-8
:3-[2-(Ethylamino)-1-hydroxyethyl]phenyl 2,2-dimethylpropanoate
Description:
3-[2-(Ethylamino)-1-hydroxyethyl]phenyl 2,2-dimethylpropanoate, with the CAS number 100696-30-8, is a chemical compound that belongs to the class of esters. It features a phenyl group substituted with a hydroxyethyl chain that contains an ethylamino group, contributing to its potential biological activity. The presence of the dimethylpropanoate moiety indicates that it has a branched structure, which may influence its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the combination of hydrophilic (hydroxy and amino groups) and hydrophobic (phenyl and alkyl groups) characteristics. Its structure suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would depend on further empirical studies. Additionally, the compound's stability, reactivity, and interactions with biological systems would be influenced by its functional groups and overall molecular architecture. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C15H23NO3
InChI:InChI=1S/C15H23NO3/c1-5-16-10-13(17)11-7-6-8-12(9-11)19-14(18)15(2,3)4/h6-9,13,16-17H,5,10H2,1-4H3
InChI key:InChIKey=DRMHNJGOEAYOIZ-UHFFFAOYSA-N
SMILES:O(C(C(C)(C)C)=O)C1=CC(C(CNCC)O)=CC=C1
Synonyms:- Etilefrine pivalate
- 3-[2-(Ethylamino)-1-hydroxyethyl]phenyl 2,2-dimethylpropanoate
- Propanoic acid, 2,2-dimethyl-, 3-[2-(ethylamino)-1-hydroxyethyl]phenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
etilefrine pivalate
CAS:<p>etilefrine pivalate is a useful organic compound for research related to life sciences. The catalog number is T68067 and the CAS number is 100696-30-8.</p>Formula:C15H23NO3Color and Shape:SolidMolecular weight:265.353
