CAS 1006961-04-1

4-[(1,5-Dimethyl-1H-pyrazol-4-yl)methoxy]-3-fluorobenzenamine

Description:

4-[(1,5-Dimethyl-1H-pyrazol-4-yl)methoxy]-3-fluorobenzenamine, identified by its CAS number 1006961-04-1, is an organic compound characterized by its complex structure, which includes a fluorobenzene moiety, a methoxy group, and a dimethylpyrazole substituent. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The fluorine atom in the benzene ring can influence the compound's electronic properties, potentially enhancing its reactivity or altering its interaction with biological targets. The dimethylpyrazole component may contribute to its biological activity, as pyrazole derivatives are often explored for their pharmacological properties. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents with specific biological activities or targeting certain pathways. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with amine functionalities.

Formula: C₁₂H₁₄FN₃O

InChI: InChI=1S/C12H14FN3O/c1-8-9(6-15-16(8)2)7-17-12-4-3-10(14)5-11(12)13/h3-6H,7,14H2,1-2H3

InChI key: InChIKey=FOSMDRHULLGTKV-UHFFFAOYSA-N

SMILES: C(OC1=C(F)C=C(N)C=C1)C2=C(C)N(C)N=C2

Synonyms:

• Benzenamine, 4-[(1,5-dimethyl-1H-pyrazol-4-yl)methoxy]-3-fluoro-
• 4-[(1,5-Dimethyl-1H-pyrazol-4-yl)methoxy]-3-fluorobenzenamine