
CAS 1006962-56-6
:5-Chloro-2-[(1-methyl-1H-pyrazol-4-yl)methoxy]benzenamine
Description:
5-Chloro-2-[(1-methyl-1H-pyrazol-4-yl)methoxy]benzenamine is an organic compound characterized by its complex structure, which includes a chloro substituent, an amine group, and a methoxy linkage to a pyrazole moiety. The presence of the chloro group typically enhances the compound's reactivity and may influence its biological activity. The amine functional group can participate in hydrogen bonding, affecting solubility and interaction with biological targets. The pyrazole ring contributes to the compound's potential pharmacological properties, as pyrazoles are often found in various bioactive molecules. This compound may exhibit properties such as moderate to high lipophilicity, depending on the balance of its functional groups, which can influence its absorption and distribution in biological systems. Additionally, the specific arrangement of substituents can lead to unique electronic properties, making it of interest in medicinal chemistry and drug development. Overall, this compound's characteristics suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents.
Formula:C11H12ClN3O
InChI:InChI=1S/C11H12ClN3O/c1-15-6-8(5-14-15)7-16-11-3-2-9(12)4-10(11)13/h2-6H,7,13H2,1H3
InChI key:InChIKey=ROGLTLPQWXTCTO-UHFFFAOYSA-N
SMILES:O(CC1=CN(C)N=C1)C2=C(N)C=C(Cl)C=C2
Synonyms:- 5-Chloro-2-[(1-methyl-1H-pyrazol-4-yl)methoxy]benzenamine
- Benzenamine, 5-chloro-2-[(1-methyl-1H-pyrazol-4-yl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.