
CAS 1006962-61-3
:5-Chloro-2-[(1,5-dimethyl-1H-pyrazol-4-yl)methoxy]benzenamine
Description:
5-Chloro-2-[(1,5-dimethyl-1H-pyrazol-4-yl)methoxy]benzenamine is a chemical compound characterized by its complex structure, which includes a chloro substituent, an amine group, and a methoxy linkage to a pyrazole moiety. The presence of the chloro group typically enhances the compound's reactivity and may influence its biological activity. The dimethyl-substituted pyrazole ring contributes to the compound's potential pharmacological properties, as pyrazoles are often associated with various biological activities, including anti-inflammatory and analgesic effects. The methoxy group serves as a functional group that can affect solubility and lipophilicity, impacting the compound's bioavailability. This compound may be of interest in medicinal chemistry and drug development due to its unique structural features, which could lead to the discovery of novel therapeutic agents. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Overall, the compound's specific properties would depend on its interactions with biological targets and its chemical environment.
Formula:C12H14ClN3O
InChI:InChI=1S/C12H14ClN3O/c1-8-9(6-15-16(8)2)7-17-12-4-3-10(13)5-11(12)14/h3-6H,7,14H2,1-2H3
InChI key:InChIKey=SNLKMLMEYSDYFD-UHFFFAOYSA-N
SMILES:C(OC1=C(N)C=C(Cl)C=C1)C2=C(C)N(C)N=C2
Synonyms:- Benzenamine, 5-chloro-2-[(1,5-dimethyl-1H-pyrazol-4-yl)methoxy]-
- 5-Chloro-2-[(1,5-dimethyl-1H-pyrazol-4-yl)methoxy]benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.