CAS 1007-06-3
:5-(2-Cyanoethyl)hydantoin
Description:
5-(2-Cyanoethyl)hydantoin is an organic compound characterized by its hydantoin structure, which features a five-membered ring containing two carbonyl groups and two nitrogen atoms. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols. Its molecular formula includes a cyanoethyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the cyano group enhances its utility in various chemical reactions, including nucleophilic substitutions and cycloadditions. 5-(2-Cyanoethyl)hydantoin is often studied for its potential in pharmaceuticals and agrochemicals, as it may serve as an intermediate in the synthesis of biologically active compounds. Additionally, its stability under standard conditions makes it a suitable candidate for further chemical modifications. Safety data indicates that, like many cyano-containing compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C6H7N3O2
InChI:InChI=1/C6H7N3O2/c7-3-1-2-4-5(10)9-6(11)8-4/h4H,1-2H2,(H2,8,9,10,11)
SMILES:C(CC1C(=NC(=N1)O)O)C#N
Synonyms:- 3-(2,5-Dioxoimidazolidin-4-yl)propanenitrile
- 4-Imidazolidinepropanenitrile, 2,5-Dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
