
CAS 1007-57-4
:2-Ethoxy-5,5-dimethyl-1,3,2-dioxaphosphorinane
Description:
2-Ethoxy-5,5-dimethyl-1,3,2-dioxaphosphorinane, with CAS number 1007-57-4, is a cyclic organophosphorus compound characterized by its unique dioxaphosphorinane structure. This compound features a five-membered ring containing both oxygen and phosphorus atoms, contributing to its distinctive chemical properties. The presence of the ethoxy group enhances its solubility in organic solvents, while the dimethyl substituents provide steric hindrance, influencing its reactivity and stability. Typically, compounds of this nature exhibit moderate to low toxicity and can act as intermediates in organic synthesis or as potential ligands in coordination chemistry. The dioxaphosphorinane framework is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the compound's properties may be influenced by factors such as temperature and solvent choice, making it a subject of interest in both academic and industrial research settings. Overall, 2-Ethoxy-5,5-dimethyl-1,3,2-dioxaphosphorinane represents a versatile class of compounds with applications in materials science and pharmaceuticals.
Formula:C7H15O3P
InChI:InChI=1S/C7H15O3P/c1-4-8-11-9-5-7(2,3)6-10-11/h4-6H2,1-3H3
InChI key:InChIKey=CNAJZRQKQRDTJQ-UHFFFAOYSA-N
SMILES:O(CC)P1OCC(C)(C)CO1
Synonyms:- Phosphorous acid, cyclic 2,2-dimethyltrimethylene ethyl ester
- 2-Ethoxy-5,5-dimethyl-1,3,2-dioxaphosphinane
- 2-Ethoxy-5,5-dimethyl-1,3,2-dioxaphosphorinane
- 1,3,2-Dioxaphosphorinane, 2-ethoxy-5,5-dimethyl-
- 2,2-Dimethyltrimethylene ethyl phosphite
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
