CAS 100708-07-4: ethyl (4-aminopiperidin-1-yl)acetate dihydrochloride
Description:Ethyl (4-aminopiperidin-1-yl)acetate dihydrochloride is a chemical compound characterized by its structure, which includes an ethyl ester group and a piperidine ring with an amino substituent. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility. It is often used in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. The presence of the amino group suggests potential basic properties, which can influence its reactivity and interaction with biological systems. Additionally, the piperidine ring contributes to its pharmacological profile, as piperidine derivatives are known to exhibit a range of biological activities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C9H20Cl2N2O2
InChI:InChI=1/C9H18N2O2.2ClH/c1-2-13-9(12)7-11-5-3-8(10)4-6-11;;/h8H,2-7,10H2,1H3;2*1H
- Synonyms:
- Ethyl (4-aminopiperidin-1-yl)acetate dihydrochloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ethyl 2-(4-aminopiperidin-1-yl)acetate dihydrochloride REF: 54-OR1022074CAS: 100708-07-4 | - - - | 297.00 €~983.00 € | Tue 15 Apr 25 |
![]() | (4-Amino-piperidin-1-yl)acetic acid ethyl ester dihydrochloride REF: 10-F046335CAS: 100708-07-4 | 98.0% | - - - | Discontinued product |
![]() | (4-Amino-piperidin-1-yl)acetic acid ethyl ester dihydrochloride REF: 3D-AEA70807CAS: 100708-07-4 | Min. 95% | - - - | Discontinued product |

(4-Amino-piperidin-1-yl)acetic acid ethyl ester dihydrochloride
Ref: 10-F046335
2g | Discontinued | Request information | |
10g | Discontinued | Request information |

(4-Amino-piperidin-1-yl)acetic acid ethyl ester dihydrochloride
Ref: 3D-AEA70807
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |