CAS 100708-07-4
:ethyl (4-aminopiperidin-1-yl)acetate dihydrochloride
Description:
Ethyl (4-aminopiperidin-1-yl)acetate dihydrochloride is a chemical compound characterized by its structure, which includes an ethyl ester group and a piperidine ring with an amino substituent. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility. It is often used in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. The presence of the amino group suggests potential basic properties, which can influence its reactivity and interaction with biological systems. Additionally, the piperidine ring contributes to its pharmacological profile, as piperidine derivatives are known to exhibit a range of biological activities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C9H20Cl2N2O2
InChI:InChI=1/C9H18N2O2.2ClH/c1-2-13-9(12)7-11-5-3-8(10)4-6-11;;/h8H,2-7,10H2,1H3;2*1H
SMILES:CCOC(=O)CN1CCC(CC1)N.Cl.Cl
Synonyms:- Ethyl (4-aminopiperidin-1-yl)acetate dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 2-(4-aminopiperidin-1-yl)acetate dihydrochloride
CAS:<p>Ethyl 2-(4-aminopiperidin-1-yl)acetate dihydrochloride</p>Molecular weight:259.1733g/mol
