CAS 1007113-05-4

5-Fluoro-3-hydroxy-2-nitrobenzoic acid

Description:

5-Fluoro-3-hydroxy-2-nitrobenzoic acid is an aromatic compound characterized by the presence of a fluorine atom, a hydroxyl group, and a nitro group attached to a benzoic acid framework. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The fluorine substitution typically enhances the compound's lipophilicity and can influence its biological activity. The hydroxyl group provides potential for hydrogen bonding, which may affect solubility and reactivity. The nitro group is known for its electron-withdrawing properties, which can alter the electronic characteristics of the aromatic ring, potentially impacting its reactivity in electrophilic substitution reactions. This compound may be of interest in pharmaceutical research and development due to its structural features, which could contribute to specific biological activities or interactions. Additionally, its unique combination of functional groups may make it a candidate for further studies in medicinal chemistry, particularly in the design of new therapeutic agents.

Formula: C₇H₄FNO₅

InChI: InChI=1S/C7H4FNO5/c8-3-1-4(7(11)12)6(9(13)14)5(10)2-3/h1-2,10H,(H,11,12)

InChI key: InChIKey=QJSNLFIKMCRDPW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C(O)=O)C=C(F)C=C1O

Synonyms:

• Benzoic acid, 5-fluoro-3-hydroxy-2-nitro-
• 5-Fluoro-3-hydroxy-2-nitrobenzoic acid