CAS 1007121-73-4

1,2,3-Oxathiazolidine-3-carboxylic acid, 4-(1-methylethyl)-, phenylmethyl ester, 2,2-dioxide, (4R)-

Description:

1,2,3-Oxathiazolidine-3-carboxylic acid, 4-(1-methylethyl)-, phenylmethyl ester, 2,2-dioxide, (4R)- is a chemical compound characterized by its unique oxathiazolidine ring structure, which incorporates both sulfur and oxygen atoms, contributing to its potential reactivity and biological activity. The presence of a carboxylic acid functional group indicates acidic properties, while the ester moiety suggests it can undergo hydrolysis or transesterification reactions. The compound's stereochemistry, denoted by the (4R) configuration, implies specific spatial arrangements that may influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of a phenylmethyl group enhances lipophilicity, potentially affecting its solubility and permeability in biological systems. The compound may exhibit various pharmacological properties, which could be explored for therapeutic applications. Overall, its structural features suggest a complex interplay of chemical properties that warrant further investigation in both synthetic and biological contexts.

Formula: C₁₃H₁₇NO₅S

InChI: InChI=1S/C13H17NO5S/c1-10(2)12-9-19-20(16,17)14(12)13(15)18-8-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t12-/m0/s1

InChI key: InChIKey=KTWMYNKXOHFOMA-LBPRGKRZSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2[C@H](C(C)C)COS2(=O)=O

Synonyms:

• 1,2,3-Oxathiazolidine-3-carboxylic acid, 4-(1-methylethyl)-, phenylmethyl ester, 2,2-dioxide, (4R)-