CAS 1007128-71-3

7-Bromo-4-chloro[1,2,5]thiadiazolo[3,4-c]pyridine

Description:

7-Bromo-4-chloro[1,2,5]thiadiazolo[3,4-c]pyridine is a heterocyclic compound characterized by its unique structure, which includes a thiadiazole ring fused to a pyridine moiety. This compound features bromine and chlorine substituents, which can influence its reactivity and biological activity. The presence of halogens often enhances the compound's lipophilicity and can affect its interaction with biological targets. The thiadiazole ring contributes to the compound's potential as a pharmacophore, making it of interest in medicinal chemistry for developing new therapeutic agents. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings. Its synthesis typically involves multi-step organic reactions, and it may be utilized in various applications, including agrochemicals and pharmaceuticals. As with many heterocycles, the specific reactivity and stability can vary based on the substituents and the overall molecular environment. Safety and handling precautions should be observed due to the presence of halogens and the potential for biological activity.

Formula: C₅HBrClN₃S

InChI: InChI=1S/C5HBrClN3S/c6-2-1-8-5(7)4-3(2)9-11-10-4/h1H

InChI key: InChIKey=AREKUZJHGQEURV-UHFFFAOYSA-N

SMILES: BrC=1C=2C(C(Cl)=NC1)=NSN2

Synonyms:

• 7-Bromo-4-chloro[1,2,5]thiadiazoleo[3,4-c]pyridine
• 7-Bromo-4-chloro[1,2,5]thiadiazolo[3,4-c]pyridine
• [1,2,5]Thiadiazolo[3,4-c]pyridine, 7-bromo-4-chloro-