CAS 1007210-99-2

3-(4-Bromophenyl)-1-(4-methyl-1-piperazinyl)-1-propanone

Description:

3-(4-Bromophenyl)-1-(4-methyl-1-piperazinyl)-1-propanone, identified by its CAS number 1007210-99-2, is a chemical compound characterized by its unique molecular structure, which includes a bromophenyl group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the bromine atom enhances its lipophilicity, which may influence its interaction with biological targets. The piperazine ring is known for its role in pharmacological activity, often contributing to the compound's ability to interact with neurotransmitter receptors. As a ketone, it features a carbonyl group that can participate in various chemical reactions, such as nucleophilic addition. The compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Overall, this substance may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, although specific biological activities would require further investigation.

Formula: C₁₄H₁₉BrN₂O

InChI: InChI=1S/C14H19BrN2O/c1-16-8-10-17(11-9-16)14(18)7-4-12-2-5-13(15)6-3-12/h2-3,5-6H,4,7-11H2,1H3

InChI key: InChIKey=UNHCRFSSNIPMEY-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Br)C=C1)(=O)N2CCN(C)CC2

Synonyms:

• 3-(4-Bromophenyl)-1-(4-methyl-1-piperazinyl)-1-propanone
• 3-(4-Bromophenyl)-1-(4-methylpiperazin-1-yl)propan-1-one
• 1-Propanone, 3-(4-bromophenyl)-1-(4-methyl-1-piperazinyl)-