CAS 1007387-46-3
:4-[(4-Chlorophenyl)methyl]-3-thiophenecarboxaldehyde
Description:
4-[(4-Chlorophenyl)methyl]-3-thiophenecarboxaldehyde is an organic compound characterized by its unique structure, which includes a thiophene ring and a chlorophenyl group. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of the 4-chlorophenyl moiety suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The thiophene ring contributes to the compound's aromaticity and may influence its solubility and stability. Additionally, the compound's molecular structure may allow for interactions with biological systems, making it a candidate for further investigation in medicinal chemistry. Its CAS number, 1007387-46-3, provides a unique identifier for regulatory and research purposes. Overall, this compound's characteristics make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C12H9ClOS
InChI:InChI=1S/C12H9ClOS/c13-12-3-1-9(2-4-12)5-10-7-15-8-11(10)6-14/h1-4,6-8H,5H2
InChI key:InChIKey=HHZQGWSGBIVHSL-UHFFFAOYSA-N
SMILES:C(C=1C(C=O)=CSC1)C2=CC=C(Cl)C=C2
Synonyms:- 4-[(4-Chlorophenyl)methyl]-3-thiophenecarboxaldehyde
- 3-Thiophenecarboxaldehyde, 4-[(4-chlorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
