CAS 100743-68-8: Propanoic acid, 2-(1-ethoxyethoxy)-, potassium salt (1:1)

Description: Propanoic acid, 2-(1-ethoxyethoxy)-, potassium salt (1:1), identified by CAS number 100743-68-8, is a chemical compound that features a propanoic acid backbone modified with an ethoxyethoxy group. This compound is a salt formed by the neutralization of propanoic acid with potassium, resulting in enhanced solubility in aqueous environments. It typically exhibits characteristics common to carboxylic acids, such as the ability to donate protons (H+) in solution, which contributes to its acidity. The presence of the ethoxyethoxy group may impart additional properties, such as increased hydrophilicity and potential surfactant behavior, making it useful in various applications, including pharmaceuticals and agrochemicals. The potassium salt form often enhances stability and bioavailability compared to its free acid counterpart. Overall, this compound is characterized by its moderate acidity, solubility in water, and potential utility in various chemical and industrial processes.

Formula: C₇H₁₄O₄·K

InChI: InChI=1S/C7H14O4.K/c1-4-10-6(3)11-5(2)7(8)9;/h5-6H,4H2,1-3H3,(H,8,9);

InChI key: InChIKey=YVYSIRDHXQCCEG-UHFFFAOYSA-N

SMILES: [K].O=C(O)C(OC(OCC)C)C

Synonyms:

• Propanoic acid, 2-(1-ethoxyethoxy)-, potassium salt
• Propanoic acid, 2-(1-ethoxyethoxy)-, potassium salt (1:1)

Propanoic acid, 2-(1-ethoxyethoxy)-, potassium salt (1:1)

CAS: 100743-68-8

• Formula: C₇H₁₄KO₄
• Molecular weight: 201.2820