CAS 1007455-24-4
:5-Fluoro-2,3-dihydro-6-methoxy-1H-isoindol-1-one
Description:
5-Fluoro-2,3-dihydro-6-methoxy-1H-isoindol-1-one is a chemical compound characterized by its isoindole structure, which features a fused bicyclic system. The presence of a fluorine atom at the 5-position and a methoxy group at the 6-position contributes to its unique reactivity and potential biological activity. This compound typically exhibits moderate to high lipophilicity due to the aromatic nature of the isoindole ring, which can influence its solubility and permeability in biological systems. The methoxy group can also participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, the dihydro form indicates the presence of saturated bonds, which may affect its stability and reactivity compared to fully aromatic compounds. Overall, 5-Fluoro-2,3-dihydro-6-methoxy-1H-isoindol-1-one is of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties.
Formula:C9H8FNO2
InChI:InChI=1S/C9H8FNO2/c1-13-8-3-6-5(2-7(8)10)4-11-9(6)12/h2-3H,4H2,1H3,(H,11,12)
InChI key:InChIKey=DUFVNTNQUIWAFV-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(F)=C(OC)C2)CN1
Synonyms:- 1H-Isoindol-1-one, 5-fluoro-2,3-dihydro-6-methoxy-
- 5-Fluoro-2,3-dihydro-6-methoxy-1H-isoindol-1-one
- 5-Fluoro-6-methoxyisoindolin-1-one
- 5-Fluoro-6-methoxy-2,3-dihydroisoindol-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.