CAS 1007455-32-4
:7-Fluoro-2,3-dihydro-6-hydroxy-1H-isoindol-1-one
Description:
7-Fluoro-2,3-dihydro-6-hydroxy-1H-isoindol-1-one is a chemical compound characterized by its unique isoindole structure, which features a fused bicyclic system. The presence of a fluorine atom at the 7-position contributes to its potential biological activity and influences its physicochemical properties, such as lipophilicity and reactivity. The hydroxyl group at the 6-position enhances its solubility in polar solvents and may participate in hydrogen bonding, affecting its interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential therapeutic applications, which may include anti-inflammatory or neuroprotective effects. Its molecular structure suggests that it could engage in various chemical reactions, making it a candidate for further research in drug development. Additionally, the compound's stability, reactivity, and biological activity can be influenced by factors such as pH and the presence of other functional groups in a given environment. Overall, 7-Fluoro-2,3-dihydro-6-hydroxy-1H-isoindol-1-one represents a fascinating subject for study in both synthetic and medicinal chemistry.
Formula:C8H6FNO2
InChI:InChI=1S/C8H6FNO2/c9-7-5(11)2-1-4-3-10-8(12)6(4)7/h1-2,11H,3H2,(H,10,12)
InChI key:InChIKey=KKGHQIBYWKTWHN-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC=C1O)CNC2=O
Synonyms:- 7-Fluoro-2,3-dihydro-6-hydroxy-1H-isoindol-1-one
- 1H-Isoindol-1-one, 7-fluoro-2,3-dihydro-6-hydroxy-
- 7-Fluoro-6-hydroxy-2,3-dihydroisoindol-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.