CAS 10075-48-6

5-BROMO-3-METHYLINDOLE

Description:

5-Bromo-3-methylindole is an organic compound that belongs to the indole family, characterized by a bicyclic structure containing a fused benzene and pyrrole ring. The presence of a bromine atom at the 5-position and a methyl group at the 3-position distinguishes this compound, influencing its chemical reactivity and biological properties. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. This compound is of interest in various fields, including medicinal chemistry and material science, due to its potential applications in pharmaceuticals and as a building block in organic synthesis. 5-Bromo-3-methylindole can participate in electrophilic aromatic substitution reactions, making it a versatile intermediate for further chemical modifications. Additionally, it may exhibit biological activity, which has led to studies exploring its effects on various biological systems. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₉H₈BrN

InChI: InChI=1/C9H8BrN/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5,11H,1H3

SMILES: Cc1c[nH]c2ccc(cc12)Br

Synonyms:

• 5-Bromo-3-methyl-1H-indole

1H-Indole, 5-bromo-3-methyl-

CAS: 10075-48-6

Formula: C₉H₈BrN

Purity: 97%

Color and Shape: Solid

Molecular weight: 210.0705

Ref: IN-DA0002SI

5-Bromo-3-methylindole

CAS: 10075-48-6

Purity: >96%

Molecular weight: 210.07

Ref: FT-B1128

5-Bromo-3-methyl-1H-indole

CAS: 10075-48-6

5-Bromo-3-methyl-1H-indole

Formula: C₉H₈BrN

Purity: 98%

Color and Shape: beige solid

Molecular weight: 210.07g/mol

Ref: 54-OR7820

5-Bromo-3-methyl-1H-indole

CAS: 10075-48-6

Formula: C₉H₈BrN

Purity: 97%

Color and Shape: Off-white crystalline powder

Molecular weight: 210.074

Ref: 10-F210723

5-Bromo-3-methylindole

CAS: 10075-48-6

5-Bromo-3-methylindole (5BMDI) is a fine chemical that is useful as a building block in the synthesis of pharmaceuticals, agricultural chemicals, and dyes.

Formula: C₉H₈BrN

Purity: Min. 90%

Molecular weight: 210.08 g/mol

Ref: 3D-B-8915