CAS 10075-51-1: 1-Benzyl-5-bromoindole
Description:1-Benzyl-5-bromoindole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 5-position of the indole ring introduces notable reactivity and influences its chemical properties, such as its potential for electrophilic substitution reactions. The benzyl group attached to the nitrogen atom of the indole enhances the compound's lipophilicity, which can affect its solubility in organic solvents and biological systems. This compound is often utilized in medicinal chemistry and research due to its potential pharmacological activities, including antitumor and antimicrobial properties. Additionally, the bromine substituent can serve as a useful handle for further chemical modifications, making it a versatile intermediate in synthetic organic chemistry. Its molecular structure contributes to its unique electronic properties, which can be exploited in various applications, including the development of novel materials and bioactive compounds.
Formula:C15H12BrN
InChI:InChI=1S/C15H12BrN/c16-14-6-7-15-13(10-14)8-9-17(15)11-12-4-2-1-3-5-12/h1-10H,11H2
InChI key:InChIKey=AQXJFUYUNHLBGU-UHFFFAOYSA-N
SMILES:BrC=1C=CC2=C(C=CN2CC=3C=CC=CC3)C1
- Synonyms:
- 1-Benzyl-5-Bromoindole
- 1H-Indole, 5-bromo-1-(phenylmethyl)-
- 5-Bromo-1-(phenylmethyl)-1H-indole
- Indole, 1-benzyl-5-bromo-
- N-Benzyl-5-bromoindole
- NSC 143237

1-Benzyl-5-bromo-1H-indole
Ref: 3B-B6090
1g | 66.00 € | ||
5g | 268.00 € |

1-Benzyl-5-bromoindole, 97%
Ref: 02-H57676
1g | 82.00 € | ||
5g | To inquire |

1-BENZYL-5-BROMO-1H-INDOLE
Ref: IN-DA008XYV
1g | 77.00 € | ||
5g | 201.00 € | ||
25g | To inquire | ||
100mg | 48.00 € | ||
250mg | 57.00 € |

Ref: 54-OR79556
1g | 57.00 € | ||
5g | 232.00 € | ||
25g | 825.00 € | ||
100g | 2,693.00 € | ||
250mg | 44.00 € |

1-Benzyl-5-bromo-1H-indole
Ref: 10-F471088
1g | 97.00 € | ||
5g | 201.00 € | ||
25g | 640.00 € |

1-Benzyl-5-bromoindole
Controlled ProductRef: TR-B300043
100mg | 99.00 € | ||
250mg | 119.00 € | ||
500mg | 136.00 € |

1-Benzyl-5-bromo-1H-indole
Ref: 3D-KAA07551
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |