CAS 100751-63-1

(6-bromonaphthalen-2-yl)methanol

Description:

(6-Bromonaphthalen-2-yl)methanol is an organic compound characterized by the presence of a naphthalene ring substituted with a bromine atom and a hydroxymethyl group. The compound features a bromine atom at the 6-position of the naphthalene ring and a hydroxymethyl (-CH2OH) group at the 2-position, which contributes to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the hydrophobic nature of the naphthalene moiety. The presence of the hydroxymethyl group allows for hydrogen bonding, which can influence its physical properties, such as melting point and boiling point. Additionally, the bromine substituent can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making this compound of interest in medicinal chemistry and materials science. Safety data should be consulted for handling, as brominated compounds can pose health risks.

Formula: C₁₁H₉BrO

InChI: InChI=1/C11H9BrO/c12-11-4-3-9-5-8(7-13)1-2-10(9)6-11/h1-6,13H,7H2

SMILES: c1cc2cc(ccc2cc1CO)Br

Synonyms:

• (6-Bromo-2-naphthyl)methanol
• 2-Naphthalenemethanol, 6-Bromo-
• 6-Bromo-2-Naphthylmethylether

2-Naphthalenemethanol, 6-bromo-

CAS: 100751-63-1

Formula: C₁₁H₉BrO

Purity: 97%

Color and Shape: Solid

Molecular weight: 237.0926

Ref: IN-DA0002T8

(6-Bromonaphthalen-2-yl)methanol

CAS: 100751-63-1

(6-Bromonaphthalen-2-yl)methanol

Purity: 99%

Molecular weight: 237.09g/mol

Ref: 54-OR75694

6-Bromo-2-naphthylmethanol

CAS: 100751-63-1

Formula: C₁₁H₉BrO

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 237.096

Ref: 10-F233521

Adapalene Impurity 3

CAS: 100751-63-1

Formula: C₁₁H₉BrO

Molecular weight: 237.1

Ref: ST-EA-CP-A48014