CAS 100751-65-3

2-Bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]naphthalene

Description:

2-Bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]naphthalene is an organic compound characterized by its complex structure, which includes a naphthalene ring substituted with a bromine atom and a silyl ether group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, such as nucleophilic substitutions. The silyl ether group enhances the compound's stability and solubility in organic solvents, which is advantageous for synthetic applications. This compound is typically used in organic synthesis, particularly in the development of more complex molecules or as an intermediate in the production of pharmaceuticals and agrochemicals. Its unique structural features also suggest potential applications in materials science, particularly in the development of functionalized polymers or coatings. As with many organobromine compounds, safety precautions should be observed due to potential toxicity and environmental concerns associated with brominated substances. Overall, 2-Bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]naphthalene is a versatile compound with significant implications in various fields of chemistry.

Formula: C₁₆H₂₁BrOSi

InChI: InChI=1S/C16H21BrOSi/c1-16(2,3)19(4,5)18-15-9-7-12-10-14(17)8-6-13(12)11-15/h6-11H,1-5H3

InChI key: InChIKey=SSFFBVWGOVGZJB-UHFFFAOYSA-N

SMILES: O([Si](C(C)(C)C)(C)C)C1=CC2=C(C=C(Br)C=C2)C=C1

Synonyms:

• 2-Bromo-6-[(tert-butyldimethylsilyl)oxy]naphthalene
• 6-Bromo-2-naphthol tert-butyldimethylsilyl ether
• Naphthalene, 2-bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-
• Silane, [(6-bromo-2-naphthalenyl)oxy](1,1-dimethylethyl)dimethyl-
• 2-Bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]naphthalene

2-(t-Butyldimethylsilyloxy)-6-bromonaphthalene

CAS: 100751-65-3

Formula: C₁₆H₂₁BrOSi

Color and Shape: Solid

Molecular weight: 337.3268

Ref: IN-DA0002T7