CAS 1007515-52-7

3-(1-Propyl-1H-pyrazol-4-yl)-2-propenoic acid

Description:

3-(1-Propyl-1H-pyrazol-4-yl)-2-propenoic acid is an organic compound characterized by its unique structure, which includes a pyrazole ring and an acrylic acid moiety. The presence of the pyrazole ring contributes to its potential biological activity, as pyrazoles are known for their diverse pharmacological properties. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid functional group, which can engage in hydrogen bonding. Its molecular structure suggests that it may participate in various chemical reactions, such as esterification or amidation, making it a versatile building block in organic synthesis. Additionally, the presence of the propyl group may influence its lipophilicity and overall reactivity. The compound's potential applications could span across medicinal chemistry, agrochemicals, or materials science, depending on its specific properties and reactivity. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.

Formula: C₉H₁₂N₂O₂

InChI: InChI=1S/C9H12N2O2/c1-2-5-11-7-8(6-10-11)3-4-9(12)13/h3-4,6-7H,2,5H2,1H3,(H,12,13)

InChI key: InChIKey=OBSLHOOQYBYGMP-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=CN(CCC)N=C1

Synonyms:

• 2-Propenoic acid, 3-(1-propyl-1H-pyrazol-4-yl)-
• 3-(1-Propyl-1H-pyrazol-4-yl)-2-propenoic acid