CAS 1007542-24-6

3-Methyl-1-(1-methylethyl)-1H-pyrazole-4-methanol

Description:

3-Methyl-1-(1-methylethyl)-1H-pyrazole-4-methanol is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and an isopropyl group attached to the pyrazole ring, contributing to its hydrophobic characteristics. The presence of a hydroxymethyl group (-CH2OH) at the 4-position of the pyrazole ring enhances its potential for hydrogen bonding, which can influence its solubility and reactivity. The compound is likely to exhibit moderate polarity due to the balance between its hydrophobic alkyl groups and the hydrophilic hydroxymethyl group. It may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₁₄N₂O

InChI: InChI=1S/C8H14N2O/c1-6(2)10-4-8(5-11)7(3)9-10/h4,6,11H,5H2,1-3H3

InChI key: InChIKey=DPYFNWLRVTXZCZ-UHFFFAOYSA-N

SMILES: C(C)(C)N1C=C(CO)C(C)=N1

Synonyms:

• 1H-Pyrazole-4-methanol, 3-methyl-1-(1-methylethyl)-
• 3-Methyl-1-(1-methylethyl)-1H-pyrazole-4-methanol