CAS 1007550-87-9
:5-Methyl-3-(trifluoromethyl)-1H-pyrazole-1-acetaldehyde
Description:
5-Methyl-3-(trifluoromethyl)-1H-pyrazole-1-acetaldehyde is an organic compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a methyl group and a trifluoromethyl group on the pyrazole ring contributes to its unique chemical properties, including increased lipophilicity and potential reactivity. The acetaldehyde functional group introduces a carbonyl moiety, which can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and agrochemical research. Its trifluoromethyl group is known to enhance metabolic stability and bioactivity, while the pyrazole framework is often associated with diverse pharmacological properties. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Overall, 5-Methyl-3-(trifluoromethyl)-1H-pyrazole-1-acetaldehyde represents a versatile building block in synthetic organic chemistry.
Formula:C7H7F3N2O
InChI:InChI=1S/C7H7F3N2O/c1-5-4-6(7(8,9)10)11-12(5)2-3-13/h3-4H,2H2,1H3
InChI key:InChIKey=XTNMEFDFWZRCGX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NN(CC=O)C(C)=C1
Synonyms:- 5-Methyl-3-(trifluoromethyl)-1H-pyrazole-1-acetaldehyde
- 1H-Pyrazole-1-acetaldehyde, 5-methyl-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.