CAS 1007554-45-1

3-Chloro-5-pyridyl-6-phenylpyridazine

Description:

3-Chloro-5-pyridyl-6-phenylpyridazine is a chemical compound characterized by its complex structure, which includes a pyridazine ring fused with pyridine and phenyl groups. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and varied solubility depending on the solvent used. The presence of chlorine in its structure may impart specific reactivity, influencing its interactions in chemical reactions and biological systems. It is often studied for its potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The molecular structure suggests that it may engage in hydrogen bonding and π-π stacking interactions, which can affect its physical properties, such as melting point and boiling point. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine and the aromatic systems present. As with many heterocycles, it may also exhibit fluorescence or other photophysical properties, making it of interest in materials science and medicinal chemistry.

Formula: C15H10ClN3

InChI: InChI=1S/C15H10ClN3/c16-14-10-13(11-6-8-17-9-7-11)15(19-18-14)12-4-2-1-3-5-12/h1-10H

InChI key: FHQYQYMBRPYWIY-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=NN=C(C=C2C3=CC=NC=C3)Cl