CymitQuimica logo

CAS 100757-08-2

:

N'-[(3E)-5-chloro-1-(morpholin-4-ylmethyl)-2-oxo-1,2-dihydro-3H-indol-3-ylidene]-3,5-dinitrobenzohydrazide

Description:
N'-[(3E)-5-chloro-1-(morpholin-4-ylmethyl)-2-oxo-1,2-dihydro-3H-indol-3-ylidene]-3,5-dinitrobenzohydrazide is a complex organic compound characterized by its unique structural features, including a hydrazide functional group and multiple aromatic and heterocyclic components. The presence of a chloro substituent and a morpholine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit properties such as antimicrobial or anticancer activity, although specific biological effects would require empirical investigation. Its dinitrobenzene moiety may also influence its reactivity and solubility in various solvents. The compound's synthesis typically involves multi-step organic reactions, highlighting its complexity. As with many such compounds, safety and handling precautions are essential due to potential toxicity associated with nitro and chloro groups. Overall, this substance represents a class of compounds that may serve as lead structures for further drug development or research into new therapeutic agents.
Formula:C20H17ClN6O7
InChI:InChI=1/C20H17ClN6O7/c21-13-1-2-17-16(9-13)18(20(29)25(17)11-24-3-5-34-6-4-24)22-23-19(28)12-7-14(26(30)31)10-15(8-12)27(32)33/h1-2,7-10H,3-6,11H2,(H,23,28)/b22-18+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.