CymitQuimica logo

CAS 1007572-07-7

:

[4-bromo-3-(3-chloro-5-cyanophenoxy)-2-fluorophenyl]acetic acid

Description:
[4-bromo-3-(3-chloro-5-cyanophenoxy)-2-fluorophenyl]acetic acid is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups and halogen substituents. This compound features a phenyl ring substituted with bromine, chlorine, and fluorine atoms, contributing to its unique chemical reactivity and potential biological activity. The presence of the acetic acid moiety indicates that it can exhibit acidic properties, which may influence its solubility and interaction with biological systems. The cyanophenoxy group suggests potential applications in pharmaceuticals or agrochemicals, as such structures are often associated with herbicidal or anti-inflammatory activities. Its molecular interactions may be influenced by the electron-withdrawing effects of the halogens and the cyano group, which can affect the compound's overall polarity and reactivity. As with many synthetic compounds, safety and handling precautions are essential, given the potential toxicity associated with halogenated organic substances. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C15H8BrClFNO3
InChI:InChI=1S/C15H8BrClFNO3/c16-12-2-1-9(5-13(20)21)14(18)15(12)22-11-4-8(7-19)3-10(17)6-11/h1-4,6H,5H2,(H,20,21)
InChI key:VEPZSBUSOHVSRO-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1CC(=O)O)F)OC2=CC(=CC(=C2)C#N)Cl)Br
Found 3 products.