CAS 1007578-83-7

3-Bromo-5-(trifluoromethyl)benzamide

Description:

3-Bromo-5-(trifluoromethyl)benzamide is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to a benzamide structure. The bromine atom is located at the meta position (3-position) relative to the amide functional group, while the trifluoromethyl group is situated at the para position (5-position) on the benzene ring. This compound is typically a solid at room temperature and exhibits a relatively high melting point due to the presence of strong intermolecular forces, including hydrogen bonding from the amide group. The trifluoromethyl group significantly enhances the compound's lipophilicity and can influence its reactivity and biological activity. 3-Bromo-5-(trifluoromethyl)benzamide may be utilized in various chemical syntheses and research applications, particularly in medicinal chemistry, where modifications to aromatic compounds can lead to the development of new pharmaceuticals. Its unique electronic properties, stemming from the electronegative fluorine atoms, can also affect its interaction with biological targets.

Formula: C₈H₅BrF₃NO

InChI: InChI=1S/C8H5BrF3NO/c9-6-2-4(7(13)14)1-5(3-6)8(10,11)12/h1-3H,(H2,13,14)

InChI key: InChIKey=NYCJLKMTNDLDGK-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(C(N)=O)=CC(Br)=C1

Synonyms:

• Benzamide, 3-bromo-5-(trifluoromethyl)-
• 3-Bromo-5-(trifluoromethyl)benzamide